C36H38N2O10 — CID 158723179
(Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 158723179) has the molecular formula C36H38N2O10 and a molecular weight of 658.70 g/mol. Its IUPAC name is (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 158723179 |
| Molecular Formula | C36H38N2O10 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C\C(=O)NCCc2ccc(O)c(O)c2)ccc1O.COc1cc(/C=C\C(=O)NCCc2ccc(O)c(O)c2)ccc1O |
| InChI | InChI=1S/2C18H19NO5/c2*1-24-17-11-12(3-6-15(17)21)4-7-18(23)19-9-8-13-2-5-14(20)16(22)10-13/h2*2-7,10-11,20-22H,8-9H2,1H3,(H,19,23)/b2*7-4- |
| InChIKey | IKEBQLQWVDISOF-JPGKMPSDSA-N |
| XLogP | 4.37 |
| TPSA | 198.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|