C8H11NNiO2 — CID 175198518
4-(2-aminoethyl)benzene-1,2-diol;nickel (PubChem CID 175198518) has the molecular formula C8H11NNiO2 and a molecular weight of 211.87 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;nickel.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;nickel |
|---|---|
| PubChem CID | 175198518 |
| Molecular Formula | C8H11NNiO2 |
| Molecular Weight | 211.87 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;nickel |
| SMILES | NCCc1ccc(O)c(O)c1.[Ni] |
| InChI | InChI=1S/C8H11NO2.Ni/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2; |
| InChIKey | UTPAXCKTRJEGLM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.87 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|