C8H11NO2 — CID 54417146
4-[2-(tritioamino)ethyl]benzene-1,2-diol (PubChem CID 54417146) has the molecular formula C8H11NO2 and a molecular weight of 155.19 g/mol. Its IUPAC name is 4-[2-(tritioamino)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-(tritioamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 54417146 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 155.19 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-[2-(tritioamino)ethyl]benzene-1,2-diol |
| SMILES | [3H]NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2/i/hT |
| InChIKey | VYFYYTLLBUKUHU-MNYXATJNSA-N |
| XLogP | 0.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|