C9H16BrNO2 — CID 18923739
azane;4-propylbenzene-1,2-diol;hydrobromide (PubChem CID 18923739) has the molecular formula C9H16BrNO2 and a molecular weight of 250.14 g/mol. Its IUPAC name is azane;4-propylbenzene-1,2-diol;hydrobromide.
| Compound Name | azane;4-propylbenzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 18923739 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | azane;4-propylbenzene-1,2-diol;hydrobromide |
| SMILES | Br.CCCc1ccc(O)c(O)c1.N |
| InChI | InChI=1S/C9H12O2.BrH.H3N/c1-2-3-7-4-5-8(10)9(11)6-7;;/h4-6,10-11H,2-3H2,1H3;1H;1H3 |
| InChIKey | ABZWEIKLDPVUPP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|