About azane;4-propylbenzene-1,2-diol;hydrobromide
azane;4-propylbenzene-1,2-diol;hydrobromide (PubChem CID 18923739) has the molecular formula C9H16BrNO2
and a molecular weight of 250.14 g/mol. Its IUPAC name is azane;4-propylbenzene-1,2-diol;hydrobromide.
Molecular Properties
| Compound Name | azane;4-propylbenzene-1,2-diol;hydrobromide |
| PubChem CID | 18923739 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | azane;4-propylbenzene-1,2-diol;hydrobromide |
| SMILES | Br.CCCc1ccc(O)c(O)c1.N |
| InChI | InChI=1S/C9H12O2.BrH.H3N/c1-2-3-7-4-5-8(10)9(11)6-7;;/h4-6,10-11H,2-3H2,1H3;1H;1H3 |
| InChIKey | ABZWEIKLDPVUPP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze azane;4-propylbenzene-1,2-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-propylbenzene-1,2-diol;hydrobromide?
The IUPAC name of azane;4-propylbenzene-1,2-diol;hydrobromide (CID 18923739) is azane;4-propylbenzene-1,2-diol;hydrobromide.
What is the SMILES notation for azane;4-propylbenzene-1,2-diol;hydrobromide?
The canonical SMILES for azane;4-propylbenzene-1,2-diol;hydrobromide is Br.CCCc1ccc(O)c(O)c1.N.
What is the InChIKey of azane;4-propylbenzene-1,2-diol;hydrobromide?
The InChIKey is ABZWEIKLDPVUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.BrH.H3N/c1-2-3-7-4-5-8(10)9(11)6-7;;/h4-6,10-11H,2-3H2,1H3;1H;1H3.
What are the key properties of azane;4-propylbenzene-1,2-diol;hydrobromide?
azane;4-propylbenzene-1,2-diol;hydrobromide has a molecular weight of 250.14 g/mol, XLogP of 2.79, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-propylbenzene-1,2-diol;hydrobromide is sourced from PubChem (CID 18923739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).