C10H16BrNO2 — CID 71442477
4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide (PubChem CID 71442477) has the molecular formula C10H16BrNO2 and a molecular weight of 262.15 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide.
| Compound Name | 4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 71442477 |
| Molecular Formula | C10H16BrNO2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide |
| SMILES | Br.CN(C)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H15NO2.BrH/c1-11(2)6-5-8-3-4-9(12)10(13)7-8;/h3-4,7,12-13H,5-6H2,1-2H3;1H |
| InChIKey | BJOVIRHSZCTSQR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|