C19H25NO3 — CID 143733640
4-[2-[4-(4-hydroxyphenyl)butan-2-yl-methylamino]ethyl]benzene-1,2-diol (PubChem CID 143733640) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-[2-[4-(4-hydroxyphenyl)butan-2-yl-methylamino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[4-(4-hydroxyphenyl)butan-2-yl-methylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 143733640 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-[2-[4-(4-hydroxyphenyl)butan-2-yl-methylamino]ethyl]benzene-1,2-diol |
| SMILES | CC(CCc1ccc(O)cc1)N(C)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H25NO3/c1-14(3-4-15-5-8-17(21)9-6-15)20(2)12-11-16-7-10-18(22)19(23)13-16/h5-10,13-14,21-23H,3-4,11-12H2,1-2H3 |
| InChIKey | LHYCMNPQEFSRFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|