C18H22N2O4 — CID 171390088
N-[2-(3,4-dihydroxyphenyl)ethyl]-N-[4-(4-hydroxyphenyl)butan-2-yl]nitrous amide (PubChem CID 171390088) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-N-[4-(4-hydroxyphenyl)butan-2-yl]nitrous amide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-N-[4-(4-hydroxyphenyl)butan-2-yl]nitrous amide |
|---|---|
| PubChem CID | 171390088 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-N-[4-(4-hydroxyphenyl)butan-2-yl]nitrous amide |
| SMILES | CC(CCc1ccc(O)cc1)N(CCc1ccc(O)c(O)c1)N=O |
| InChI | InChI=1S/C18H22N2O4/c1-13(2-3-14-4-7-16(21)8-5-14)20(19-24)11-10-15-6-9-17(22)18(23)12-15/h4-9,12-13,21-23H,2-3,10-11H2,1H3 |
| InChIKey | NQRXVRKDRWZQRV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|