C13H22ClNO2 — CID 90672365
4-[2-[ethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride (PubChem CID 90672365) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-[2-[ethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride.
| Compound Name | 4-[2-[ethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 90672365 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[2-[ethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCN(CC)CCc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-3-8-14(4-2)9-7-11-5-6-12(15)13(16)10-11;/h5-6,10,15-16H,3-4,7-9H2,1-2H3;1H |
| InChIKey | LJFOEALCMNLSSL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|