C14H24ClNO2 — CID 90672367
4-[2-[butyl(ethyl)amino]ethyl]benzene-1,2-diol;hydrochloride (PubChem CID 90672367) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is 4-[2-[butyl(ethyl)amino]ethyl]benzene-1,2-diol;hydrochloride.
| Compound Name | 4-[2-[butyl(ethyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 90672367 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[2-[butyl(ethyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCCN(CC)CCc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C14H23NO2.ClH/c1-3-5-9-15(4-2)10-8-12-6-7-13(16)14(17)11-12;/h6-7,11,16-17H,3-5,8-10H2,1-2H3;1H |
| InChIKey | JDHYNLAAZVFEGS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|