C16H28ClNO2 — CID 90672369
4-[2-[pentyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride (PubChem CID 90672369) has the molecular formula C16H28ClNO2 and a molecular weight of 301.86 g/mol. Its IUPAC name is 4-[2-[pentyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride.
| Compound Name | 4-[2-[pentyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 90672369 |
| Molecular Formula | C16H28ClNO2 |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-[2-[pentyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCCCN(CCC)CCc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C16H27NO2.ClH/c1-3-5-6-11-17(10-4-2)12-9-14-7-8-15(18)16(19)13-14;/h7-8,13,18-19H,3-6,9-12H2,1-2H3;1H |
| InChIKey | IJCGKHWAKFIYKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|