C27H42Cl2N2O3 — CID 67943421
4-[[(2R)-1-[5-[2-(4-hydroxyphenyl)ethyl-propylamino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol;dihydrochloride (PubChem CID 67943421) has the molecular formula C27H42Cl2N2O3 and a molecular weight of 513.55 g/mol. Its IUPAC name is 4-[[(2R)-1-[5-[2-(4-hydroxyphenyl)ethyl-propylamino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol;dihydrochloride.
| Compound Name | 4-[[(2R)-1-[5-[2-(4-hydroxyphenyl)ethyl-propylamino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 67943421 |
| Molecular Formula | C27H42Cl2N2O3 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 4-[[(2R)-1-[5-[2-(4-hydroxyphenyl)ethyl-propylamino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol;dihydrochloride |
| SMILES | CCCN(CCCCCN1CCC[C@@H]1Cc1ccc(O)c(O)c1)CCc1ccc(O)cc1.Cl.Cl |
| InChI | InChI=1S/C27H40N2O3.2ClH/c1-2-15-28(19-14-22-8-11-25(30)12-9-22)16-4-3-5-17-29-18-6-7-24(29)20-23-10-13-26(31)27(32)21-23;;/h8-13,21,24,30-32H,2-7,14-20H2,1H3;2*1H/t24-;;/m1../s1 |
| InChIKey | PRABXKNMQYDIFI-PPLJNSMQSA-N |
| XLogP | 5.78 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|