C28H42N2O3 — CID 67943428
4-[[(2R)-1-[5-[butyl-[2-(4-hydroxyphenyl)ethyl]amino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol (PubChem CID 67943428) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is 4-[[(2R)-1-[5-[butyl-[2-(4-hydroxyphenyl)ethyl]amino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(2R)-1-[5-[butyl-[2-(4-hydroxyphenyl)ethyl]amino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67943428 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 4-[[(2R)-1-[5-[butyl-[2-(4-hydroxyphenyl)ethyl]amino]pentyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCN(CCCCCN1CCC[C@@H]1Cc1ccc(O)c(O)c1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C28H42N2O3/c1-2-3-16-29(20-15-23-9-12-26(31)13-10-23)17-5-4-6-18-30-19-7-8-25(30)21-24-11-14-27(32)28(33)22-24/h9-14,22,25,31-33H,2-8,15-21H2,1H3/t25-/m1/s1 |
| InChIKey | VZVWIINIVWRRHK-RUZDIDTESA-N |
| XLogP | 5.33 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|