C29H44N2O3 — CID 67943405
4-[[1-[7-[2-(4-hydroxyphenyl)ethyl-propylamino]heptyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol (PubChem CID 67943405) has the molecular formula C29H44N2O3 and a molecular weight of 468.68 g/mol. Its IUPAC name is 4-[[1-[7-[2-(4-hydroxyphenyl)ethyl-propylamino]heptyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol.
| Compound Name | 4-[[1-[7-[2-(4-hydroxyphenyl)ethyl-propylamino]heptyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67943405 |
| Molecular Formula | C29H44N2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | 4-[[1-[7-[2-(4-hydroxyphenyl)ethyl-propylamino]heptyl]pyrrolidin-2-yl]methyl]benzene-1,2-diol |
| SMILES | CCCN(CCCCCCCN1CCCC1Cc1ccc(O)c(O)c1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C29H44N2O3/c1-2-17-30(21-16-24-10-13-27(32)14-11-24)18-6-4-3-5-7-19-31-20-8-9-26(31)22-25-12-15-28(33)29(34)23-25/h10-15,23,26,32-34H,2-9,16-22H2,1H3 |
| InChIKey | WBJIABYHEWNDME-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|