C28H44Br2N2O4 — CID 67943419
4-[2-[6-[(2S)-2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl-propylamino]ethyl]benzene-1,2-diol;dihydrobromide (PubChem CID 67943419) has the molecular formula C28H44Br2N2O4 and a molecular weight of 632.48 g/mol. Its IUPAC name is 4-[2-[6-[(2S)-2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl-propylamino]ethyl]benzene-1,2-diol;dihydrobromide.
| Compound Name | 4-[2-[6-[(2S)-2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl-propylamino]ethyl]benzene-1,2-diol;dihydrobromide |
|---|---|
| PubChem CID | 67943419 |
| Molecular Formula | C28H44Br2N2O4 |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | 4-[2-[6-[(2S)-2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl-propylamino]ethyl]benzene-1,2-diol;dihydrobromide |
| SMILES | Br.Br.CCCN(CCCCCCN1CCC[C@H]1Cc1ccc(O)c(O)c1)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H42N2O4.2BrH/c1-2-14-29(18-13-22-9-11-25(31)27(33)20-22)15-5-3-4-6-16-30-17-7-8-24(30)19-23-10-12-26(32)28(34)21-23;;/h9-12,20-21,24,31-34H,2-8,13-19H2,1H3;2*1H/t24-;;/m0../s1 |
| InChIKey | NCHMCFWELUYXII-ASMAMLKCSA-N |
| XLogP | 6.19 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|