C29H44N2O4 — CID 67943472
4-[2-[butyl-[6-[2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl]amino]ethyl]benzene-1,2-diol (PubChem CID 67943472) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is 4-[2-[butyl-[6-[2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl]amino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[butyl-[6-[2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl]amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67943472 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 4-[2-[butyl-[6-[2-[(3,4-dihydroxyphenyl)methyl]pyrrolidin-1-yl]hexyl]amino]ethyl]benzene-1,2-diol |
| SMILES | CCCCN(CCCCCCN1CCCC1Cc1ccc(O)c(O)c1)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H44N2O4/c1-2-3-15-30(19-14-23-10-12-26(32)28(34)21-23)16-6-4-5-7-17-31-18-8-9-25(31)20-24-11-13-27(33)29(35)22-24/h10-13,21-22,25,32-35H,2-9,14-20H2,1H3 |
| InChIKey | QZOGDYNGISGSJT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|