C13H19NO3 — CID 113199070
N-butyl-2-(3,4-dihydroxyphenyl)-N-methylacetamide (PubChem CID 113199070) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-butyl-2-(3,4-dihydroxyphenyl)-N-methylacetamide.
| Compound Name | N-butyl-2-(3,4-dihydroxyphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 113199070 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-butyl-2-(3,4-dihydroxyphenyl)-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H19NO3/c1-3-4-7-14(2)13(17)9-10-5-6-11(15)12(16)8-10/h5-6,8,15-16H,3-4,7,9H2,1-2H3 |
| InChIKey | HOUXEARPMJDLQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|