C13H20N2O3 — CID 61154334
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-propylpropanamide (PubChem CID 61154334) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-propylpropanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-propylpropanamide |
|---|---|
| PubChem CID | 61154334 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-propylpropanamide |
| SMILES | CCCN(C)C(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-3-6-15(2)13(18)10(14)7-9-4-5-11(16)12(17)8-9/h4-5,8,10,16-17H,3,6-7,14H2,1-2H3/t10-/m0/s1 |
| InChIKey | AZBASDDVSUYGCA-JTQLQIEISA-N |
| XLogP | 0.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|