C16H26N2O3 — CID 61165243
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-(4-methylpentan-2-yl)propanamide (PubChem CID 61165243) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-(4-methylpentan-2-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-(4-methylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 61165243 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-methyl-N-(4-methylpentan-2-yl)propanamide |
| SMILES | CC(C)CC(C)N(C)C(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-10(2)7-11(3)18(4)16(21)13(17)8-12-5-6-14(19)15(20)9-12/h5-6,9-11,13,19-20H,7-8,17H2,1-4H3/t11?,13-/m0/s1 |
| InChIKey | GEVWYPUFSRARKI-YUZLPWPTSA-N |
| XLogP | 1.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|