About 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol
4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol (PubChem CID 173195865) has the molecular formula C13H22N2O4
and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol |
| PubChem CID | 173195865 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol |
| SMILES | CN(CCc1ccc(O)c(O)c1)N(CCO)CCO |
| InChI | InChI=1S/C13H22N2O4/c1-14(15(6-8-16)7-9-17)5-4-11-2-3-12(18)13(19)10-11/h2-3,10,16-19H,4-9H2,1H3 |
| InChIKey | DSIUNCNFKCRYNS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol?
The IUPAC name of 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol (CID 173195865) is 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol?
The canonical SMILES for 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol is CN(CCc1ccc(O)c(O)c1)N(CCO)CCO.
What is the InChIKey of 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol?
The InChIKey is DSIUNCNFKCRYNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4/c1-14(15(6-8-16)7-9-17)5-4-11-2-3-12(18)13(19)10-11/h2-3,10,16-19H,4-9H2,1H3.
What are the key properties of 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol?
4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol has a molecular weight of 270.33 g/mol, XLogP of -0.23, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[bis(2-hydroxyethyl)amino]-methylamino]ethyl]benzene-1,2-diol is sourced from PubChem (CID 173195865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).