C12H15NO6 — CID 20530619
[acetyloxy-[2-(3,4-dihydroxyphenyl)ethyl]amino] acetate (PubChem CID 20530619) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is [acetyloxy-[2-(3,4-dihydroxyphenyl)ethyl]amino] acetate.
| Compound Name | [acetyloxy-[2-(3,4-dihydroxyphenyl)ethyl]amino] acetate |
|---|---|
| PubChem CID | 20530619 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [acetyloxy-[2-(3,4-dihydroxyphenyl)ethyl]amino] acetate |
| SMILES | CC(=O)ON(CCc1ccc(O)c(O)c1)OC(C)=O |
| InChI | InChI=1S/C12H15NO6/c1-8(14)18-13(19-9(2)15)6-5-10-3-4-11(16)12(17)7-10/h3-4,7,16-17H,5-6H2,1-2H3 |
| InChIKey | KTIKVTGZQKZZLZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|