C10H13NO3 — CID 15132211
3-(3,4-dihydroxyphenyl)-N-methylpropanamide (PubChem CID 15132211) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-methylpropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 15132211 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-methylpropanamide |
| SMILES | CNC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO3/c1-11-10(14)5-3-7-2-4-8(12)9(13)6-7/h2,4,6,12-13H,3,5H2,1H3,(H,11,14) |
| InChIKey | JVUOHGAGHQZZJW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|