C14H15NO — CID 47293107
N-methyl-3-naphthalen-2-ylpropanamide (PubChem CID 47293107) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is N-methyl-3-naphthalen-2-ylpropanamide.
| Compound Name | N-methyl-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 47293107 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-methyl-3-naphthalen-2-ylpropanamide |
| SMILES | CNC(=O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H15NO/c1-15-14(16)9-7-11-6-8-12-4-2-3-5-13(12)10-11/h2-6,8,10H,7,9H2,1H3,(H,15,16) |
| InChIKey | GRHYBFVRZHUOCW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |