C22H28N2O4 — CID 139673631
3-(3-ethyl-4-hydroxyphenyl)-N'-[3-(3-ethyl-4-hydroxyphenyl)propanoyl]propanehydrazide (PubChem CID 139673631) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(3-ethyl-4-hydroxyphenyl)-N'-[3-(3-ethyl-4-hydroxyphenyl)propanoyl]propanehydrazide.
| Compound Name | 3-(3-ethyl-4-hydroxyphenyl)-N'-[3-(3-ethyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 139673631 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-(3-ethyl-4-hydroxyphenyl)-N'-[3-(3-ethyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
| SMILES | CCc1cc(CCC(=O)NNC(=O)CCc2ccc(O)c(CC)c2)ccc1O |
| InChI | InChI=1S/C22H28N2O4/c1-3-17-13-15(5-9-19(17)25)7-11-21(27)23-24-22(28)12-8-16-6-10-20(26)18(4-2)14-16/h5-6,9-10,13-14,25-26H,3-4,7-8,11-12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | BNXHDQMMXHPPML-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|