C12H15NO3 — CID 175463692
3-(3,4-dihydroxyphenyl)-N-prop-1-enylpropanamide (PubChem CID 175463692) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-prop-1-enylpropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-prop-1-enylpropanamide |
|---|---|
| PubChem CID | 175463692 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-prop-1-enylpropanamide |
| SMILES | CC=CNC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H15NO3/c1-2-7-13-12(16)6-4-9-3-5-10(14)11(15)8-9/h2-3,5,7-8,14-15H,4,6H2,1H3,(H,13,16) |
| InChIKey | KXBOWXHYXJXTKJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|