C14H19NO5S — CID 21105779
2-[3-(3,4-dihydroxyphenyl)propanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 21105779) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)propanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)propanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 21105779 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)propanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CCc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C14H19NO5S/c1-21-7-6-10(14(19)20)15-13(18)5-3-9-2-4-11(16)12(17)8-9/h2,4,8,10,16-17H,3,5-7H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | GWAUMVUKTGZJHI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|