C14H17NO6S — CID 88752991
(2S)-2-(3-acetylsulfanylpropanoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 88752991) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is (2S)-2-(3-acetylsulfanylpropanoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(3-acetylsulfanylpropanoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 88752991 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (2S)-2-(3-acetylsulfanylpropanoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CC(=O)SCCC(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C14H17NO6S/c1-8(16)22-5-4-13(19)15-10(14(20)21)6-9-2-3-11(17)12(18)7-9/h2-3,7,10,17-18H,4-6H2,1H3,(H,15,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | ILESWGOHVYQDES-JTQLQIEISA-N |
| XLogP | 0.88 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|