C14H22N4O5Y-2 — CID 168967575
aminoazanide;[5-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-5-oxopentyl]azanide;yttrium (PubChem CID 168967575) has the molecular formula C14H22N4O5Y-2 and a molecular weight of 415.26 g/mol. Its IUPAC name is aminoazanide;[5-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-5-oxopentyl]azanide;yttrium.
| Compound Name | aminoazanide;[5-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-5-oxopentyl]azanide;yttrium |
|---|---|
| PubChem CID | 168967575 |
| Molecular Formula | C14H22N4O5Y-2 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | aminoazanide;[5-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-5-oxopentyl]azanide;yttrium |
| SMILES | [NH-]CCCCC(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O.[NH-]N.[Y] |
| InChI | InChI=1S/C14H19N2O5.H3N2.Y/c15-6-2-1-3-13(19)16-10(14(20)21)7-9-4-5-11(17)12(18)8-9;1-2;/h4-5,8,10,15,17-18H,1-3,6-7H2,(H,16,19)(H,20,21);1H,2H2;/q2*-1; |
| InChIKey | WBRFIRNBMUTYCI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 180.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|