C12H17N3O5 — CID 61403134
2-(2-aminoethylcarbamoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 61403134) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(2-aminoethylcarbamoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-(2-aminoethylcarbamoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 61403134 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(2-aminoethylcarbamoylamino)-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | NCCNC(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C12H17N3O5/c13-3-4-14-12(20)15-8(11(18)19)5-7-1-2-9(16)10(17)6-7/h1-2,6,8,16-17H,3-5,13H2,(H,18,19)(H2,14,15,20) |
| InChIKey | SOQDPSSMGMDZNL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|