C13H18N2O5 — CID 62638802
(2S)-3-(3,4-dihydroxyphenyl)-2-[2-(methylamino)propanoylamino]propanoic acid (PubChem CID 62638802) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(methylamino)propanoylamino]propanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(methylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 62638802 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[2-(methylamino)propanoylamino]propanoic acid |
| SMILES | CNC(C)C(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-7(14-2)12(18)15-9(13(19)20)5-8-3-4-10(16)11(17)6-8/h3-4,6-7,9,14,16-17H,5H2,1-2H3,(H,15,18)(H,19,20)/t7?,9-/m0/s1 |
| InChIKey | MMRNFHWSKVZITL-NETXQHHPSA-N |
| XLogP | -0.18 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|