C14H22ClN2O5+ — CID 143522252
[1-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]azanium;chloromethane (PubChem CID 143522252) has the molecular formula C14H22ClN2O5+ and a molecular weight of 333.79 g/mol. Its IUPAC name is [1-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]azanium;chloromethane.
| Compound Name | [1-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]azanium;chloromethane |
|---|---|
| PubChem CID | 143522252 |
| Molecular Formula | C14H22ClN2O5+ |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [1-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]azanium;chloromethane |
| SMILES | CC(C)([NH3+])C(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O.CCl |
| InChI | InChI=1S/C13H18N2O5.CH3Cl/c1-13(2,14)12(20)15-8(11(18)19)5-7-3-4-9(16)10(17)6-7;1-2/h3-4,6,8,16-17H,5,14H2,1-2H3,(H,15,20)(H,18,19);1H3/p+1 |
| InChIKey | KWTJSRMDYFYTAS-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|