C13H16N2O5 — CID 24738911
(2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 24738911) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 24738911 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-2-[(1-aminocyclopropanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | NC1(C(=O)N[C@@H](Cc2ccc(O)c(O)c2)C(=O)O)CC1 |
| InChI | InChI=1S/C13H16N2O5/c14-13(3-4-13)12(20)15-8(11(18)19)5-7-1-2-9(16)10(17)6-7/h1-2,6,8,16-17H,3-5,14H2,(H,15,20)(H,18,19)/t8-/m0/s1 |
| InChIKey | ICMGLEAZOUIFPG-QMMMGPOBSA-N |
| XLogP | -0.30 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|