C9H12N2O6S — CID 104985718
(2S)-3-(3,4-dihydroxyphenyl)-2-(sulfamoylamino)propanoic acid (PubChem CID 104985718) has the molecular formula C9H12N2O6S and a molecular weight of 276.27 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-(sulfamoylamino)propanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-(sulfamoylamino)propanoic acid |
|---|---|
| PubChem CID | 104985718 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-(sulfamoylamino)propanoic acid |
| SMILES | NS(=O)(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H12N2O6S/c10-18(16,17)11-6(9(14)15)3-5-1-2-7(12)8(13)4-5/h1-2,4,6,11-13H,3H2,(H,14,15)(H2,10,16,17)/t6-/m0/s1 |
| InChIKey | VEWWIAPVFWWASM-LURJTMIESA-N |
| XLogP | -1.11 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|