C11H15NO6S — CID 61069877
3-(3,4-dihydroxyphenyl)-2-(ethylsulfonylamino)propanoic acid (PubChem CID 61069877) has the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(ethylsulfonylamino)propanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(ethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 61069877 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(ethylsulfonylamino)propanoic acid |
| SMILES | CCS(=O)(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H15NO6S/c1-2-19(17,18)12-8(11(15)16)5-7-3-4-9(13)10(14)6-7/h3-4,6,8,12-14H,2,5H2,1H3,(H,15,16) |
| InChIKey | ASNAUDSZMKTNIC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|