C14H17N3O4 — CID 175725450
(2S)-3-(3,4-dihydroxyphenyl)-2-[(4-ethylimidazol-1-yl)amino]propanoic acid (PubChem CID 175725450) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[(4-ethylimidazol-1-yl)amino]propanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[(4-ethylimidazol-1-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 175725450 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[(4-ethylimidazol-1-yl)amino]propanoic acid |
| SMILES | CCc1cn(N[C@@H](Cc2ccc(O)c(O)c2)C(=O)O)cn1 |
| InChI | InChI=1S/C14H17N3O4/c1-2-10-7-17(8-15-10)16-11(14(20)21)5-9-3-4-12(18)13(19)6-9/h3-4,6-8,11,16,18-19H,2,5H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | RDDVVQVYOMDMIG-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|