C15H23NO6 — CID 142261383
3-(3,4-dihydroxyphenyl)-2-formamidopropanoic acid;2-methoxy-2-methylpropane (PubChem CID 142261383) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-formamidopropanoic acid;2-methoxy-2-methylpropane.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-formamidopropanoic acid;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 142261383 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-formamidopropanoic acid;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.O=CNC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H11NO5.C5H12O/c12-5-11-7(10(15)16)3-6-1-2-8(13)9(14)4-6;1-5(2,3)6-4/h1-2,4-5,7,13-14H,3H2,(H,11,12)(H,15,16);1-4H3 |
| InChIKey | BYXNIDVBHLWIPV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|