C14H20O4 — CID 161196928
2-[(3,4-dihydroxyphenyl)methyl]-4,4-dimethylpentanoic acid (PubChem CID 161196928) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 161196928 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C14H20O4/c1-14(2,3)8-10(13(17)18)6-9-4-5-11(15)12(16)7-9/h4-5,7,10,15-16H,6,8H2,1-3H3,(H,17,18) |
| InChIKey | UULUHMBGLCVKKL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|