C10H14ClNO5 — CID 70443121
3-(3,4-dihydroxyphenyl)-2-(hydroxymethylamino)propanoic acid;hydrochloride (PubChem CID 70443121) has the molecular formula C10H14ClNO5 and a molecular weight of 263.68 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(hydroxymethylamino)propanoic acid;hydrochloride.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(hydroxymethylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70443121 |
| Molecular Formula | C10H14ClNO5 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(hydroxymethylamino)propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(Cc1ccc(O)c(O)c1)NCO |
| InChI | InChI=1S/C10H13NO5.ClH/c12-5-11-7(10(15)16)3-6-1-2-8(13)9(14)4-6;/h1-2,4,7,11-14H,3,5H2,(H,15,16);1H |
| InChIKey | FZPMMUGUSPZOBT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|