C9H10N4O4 — CID 19107651
2-(2-diazohydrazinyl)-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 19107651) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(2-diazohydrazinyl)-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-(2-diazohydrazinyl)-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19107651 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-(2-diazohydrazinyl)-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | [N-]=[N+]=NNC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H10N4O4/c10-12-13-11-6(9(16)17)3-5-1-2-7(14)8(15)4-5/h1-2,4,6,11,14-15H,3H2,(H,16,17) |
| InChIKey | JYOWLPAKNLVUII-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|