C11H16N2O6S — CID 3251990
3-(3,4-dihydroxyphenyl)-2-(dimethylsulfamoylamino)propanoic acid (PubChem CID 3251990) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(dimethylsulfamoylamino)propanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(dimethylsulfamoylamino)propanoic acid |
|---|---|
| PubChem CID | 3251990 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(dimethylsulfamoylamino)propanoic acid |
| SMILES | CN(C)S(=O)(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H16N2O6S/c1-13(2)20(18,19)12-8(11(16)17)5-7-3-4-9(14)10(15)6-7/h3-4,6,8,12,14-15H,5H2,1-2H3,(H,16,17) |
| InChIKey | PKSBMYZHKUGLPZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|