C20H20N2O11 — CID 175283276
2-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]carbamoyloxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 175283276) has the molecular formula C20H20N2O11 and a molecular weight of 464.38 g/mol. Its IUPAC name is 2-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]carbamoyloxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]carbamoyloxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 175283276 |
| Molecular Formula | C20H20N2O11 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]carbamoyloxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(O)c(O)c1)C(=O)O)OC(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C20H20N2O11/c23-13-3-1-9(7-15(13)25)5-11(17(27)28)21-19(31)33-20(32)22-12(18(29)30)6-10-2-4-14(24)16(26)8-10/h1-4,7-8,11-12,23-26H,5-6H2,(H,21,31)(H,22,32)(H,27,28)(H,29,30) |
| InChIKey | KYBDHBNMIXLVDP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 222.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|