C10H12ClNO3 — CID 160509482
(3S)-3-(chloroamino)-4-(3,4-dihydroxyphenyl)butan-2-one (PubChem CID 160509482) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is (3S)-3-(chloroamino)-4-(3,4-dihydroxyphenyl)butan-2-one.
| Compound Name | (3S)-3-(chloroamino)-4-(3,4-dihydroxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 160509482 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (3S)-3-(chloroamino)-4-(3,4-dihydroxyphenyl)butan-2-one |
| SMILES | CC(=O)[C@H](Cc1ccc(O)c(O)c1)NCl |
| InChI | InChI=1S/C10H12ClNO3/c1-6(13)8(12-11)4-7-2-3-9(14)10(15)5-7/h2-3,5,8,12,14-15H,4H2,1H3/t8-/m0/s1 |
| InChIKey | QSVXDEZRFWDMRV-QMMMGPOBSA-N |
| XLogP | 1.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|