C19H22N2O7 — CID 22788076
methyl (2S)-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 22788076) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 22788076 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H22N2O7/c1-28-19(27)13(7-11-3-5-15(23)17(25)9-11)21-18(26)12(20)6-10-2-4-14(22)16(24)8-10/h2-5,8-9,12-13,22-25H,6-7,20H2,1H3,(H,21,26)/t12-,13-/m0/s1 |
| InChIKey | BMIDBQAJCHOTOL-STQMWFEESA-N |
| XLogP | 0.28 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|