C12H17NO5S — CID 30046268
(2S)-3-(4-hydroxyphenyl)-2-(propylsulfonylamino)propanoic acid (PubChem CID 30046268) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-(propylsulfonylamino)propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-(propylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 30046268 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-(propylsulfonylamino)propanoic acid |
| SMILES | CCCS(=O)(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H17NO5S/c1-2-7-19(17,18)13-11(12(15)16)8-9-3-5-10(14)6-4-9/h3-6,11,13-14H,2,7-8H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | DXOOGCYGMGTDDH-NSHDSACASA-N |
| XLogP | 0.72 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |