C12H17NO5S — CID 55009884
2-(2-methoxyethylsulfonylamino)-3-phenylpropanoic acid (PubChem CID 55009884) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfonylamino)-3-phenylpropanoic acid.
| Compound Name | 2-(2-methoxyethylsulfonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 55009884 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(2-methoxyethylsulfonylamino)-3-phenylpropanoic acid |
| SMILES | COCCS(=O)(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H17NO5S/c1-18-7-8-19(16,17)13-11(12(14)15)9-10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3,(H,14,15) |
| InChIKey | WKTBLNMADRCTJD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |