C17H27NO7S2 — CID 138111077
2-(butylsulfonylamino)-3-(4-butylsulfonyloxyphenyl)propanoic acid (PubChem CID 138111077) has the molecular formula C17H27NO7S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-3-(4-butylsulfonyloxyphenyl)propanoic acid.
| Compound Name | 2-(butylsulfonylamino)-3-(4-butylsulfonyloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 138111077 |
| Molecular Formula | C17H27NO7S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(butylsulfonylamino)-3-(4-butylsulfonyloxyphenyl)propanoic acid |
| SMILES | CCCCS(=O)(=O)NC(Cc1ccc(OS(=O)(=O)CCCC)cc1)C(=O)O |
| InChI | InChI=1S/C17H27NO7S2/c1-3-5-11-26(21,22)18-16(17(19)20)13-14-7-9-15(10-8-14)25-27(23,24)12-6-4-2/h7-10,16,18H,3-6,11-13H2,1-2H3,(H,19,20) |
| InChIKey | BZTDKIJRNKFZQB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|