C22H32N2O5S — CID 52982827
(2S)-2-(butylsulfonylamino)-3-[4-[4-(4,5-didehydro-3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]propanoic acid (PubChem CID 52982827) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-3-[4-[4-(4,5-didehydro-3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(butylsulfonylamino)-3-[4-[4-(4,5-didehydro-3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 52982827 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-3-[4-[4-(4,5-didehydro-3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]propanoic acid |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCN2CC#CCC2)cc1)C(=O)O |
| InChI | InChI=1S/C22H32N2O5S/c1-2-3-17-30(27,28)23-21(22(25)26)18-19-9-11-20(12-10-19)29-16-8-7-15-24-13-5-4-6-14-24/h9-12,21,23H,2-3,5,7-8,13-18H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | HGEDKZMZZUEETJ-NRFANRHFSA-N |
| XLogP | 2.27 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|