C24H40N2O7S — CID 10458660
(2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoic acid (PubChem CID 10458660) has the molecular formula C24H40N2O7S and a molecular weight of 500.66 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10458660 |
| Molecular Formula | C24H40N2O7S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoic acid |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCCNC(=O)OC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C24H40N2O7S/c1-5-6-17-34(30,31)26-21(22(27)28)18-19-11-13-20(14-12-19)32-16-10-8-7-9-15-25-23(29)33-24(2,3)4/h11-14,21,26H,5-10,15-18H2,1-4H3,(H,25,29)(H,27,28)/t21-/m0/s1 |
| InChIKey | DNGGCGQOAHMAJP-NRFANRHFSA-N |
| XLogP | 3.87 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|