C19H32N4O5S — CID 59925523
(2S)-2-(butylsulfonylamino)-3-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]propanoic acid (PubChem CID 59925523) has the molecular formula C19H32N4O5S and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-3-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(butylsulfonylamino)-3-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59925523 |
| Molecular Formula | C19H32N4O5S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-3-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]propanoic acid |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCN=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C19H32N4O5S/c1-2-3-13-29(26,27)23-17(18(24)25)14-15-7-9-16(10-8-15)28-12-6-4-5-11-22-19(20)21/h7-10,17,23H,2-6,11-14H2,1H3,(H,24,25)(H4,20,21,22)/t17-/m0/s1 |
| InChIKey | ONAJCQPIRKDABR-KRWDZBQOSA-N |
| XLogP | 1.22 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|