C25H38N4O5S — CID 23576963
3-[4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-[(7,7-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid (PubChem CID 23576963) has the molecular formula C25H38N4O5S and a molecular weight of 506.67 g/mol. Its IUPAC name is 3-[4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-[(7,7-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid.
| Compound Name | 3-[4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-[(7,7-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 23576963 |
| Molecular Formula | C25H38N4O5S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 3-[4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-[(7,7-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid |
| SMILES | C=C1CC2CCC1(CS(=O)(=O)NC(Cc1ccc(OCCCCN=C(N)N)cc1)C(=O)O)C2(C)C |
| InChI | InChI=1S/C25H38N4O5S/c1-17-14-19-10-11-25(17,24(19,2)3)16-35(32,33)29-21(22(30)31)15-18-6-8-20(9-7-18)34-13-5-4-12-28-23(26)27/h6-9,19,21,29H,1,4-5,10-16H2,2-3H3,(H,30,31)(H4,26,27,28) |
| InChIKey | SFCTUBJFFOYPFV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|