C23H32N4O6S — CID 59925521
(2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid (PubChem CID 59925521) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 59925521 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)N[C@@H](Cc1ccc(OCCCCN=[N+]=[N-])cc1)C(=O)O)C(=O)C2 |
| InChI | InChI=1S/C23H32N4O6S/c1-22(2)17-9-10-23(22,20(28)14-17)15-34(31,32)26-19(21(29)30)13-16-5-7-18(8-6-16)33-12-4-3-11-25-27-24/h5-8,17,19,26H,3-4,9-15H2,1-2H3,(H,29,30)/t17?,19-,23?/m0/s1 |
| InChIKey | DQTSVHPTOZSDRK-YZOUICBYSA-N |
| XLogP | 3.47 |
| TPSA | 158.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|